C13H11F2N3O3 — CID 7941086
N-[4-(difluoromethoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide (PubChem CID 7941086) has the molecular formula C13H11F2N3O3 and a molecular weight of 295.25 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 7941086 |
| Molecular Formula | C13H11F2N3O3 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-1-methyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(OC(F)F)cc2)ccc1=O |
| InChI | InChI=1S/C13H11F2N3O3/c1-18-11(19)7-6-10(17-18)12(20)16-8-2-4-9(5-3-8)21-13(14)15/h2-7,13H,1H3,(H,16,20) |
| InChIKey | XUOBDBLLPMNTNC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |