C14H12N6O2 — CID 86998524
1-methyl-6-oxo-N-[4-(triazol-2-yl)phenyl]pyridazine-3-carboxamide (PubChem CID 86998524) has the molecular formula C14H12N6O2 and a molecular weight of 296.29 g/mol. Its IUPAC name is 1-methyl-6-oxo-N-[4-(triazol-2-yl)phenyl]pyridazine-3-carboxamide.
| Compound Name | 1-methyl-6-oxo-N-[4-(triazol-2-yl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 86998524 |
| Molecular Formula | C14H12N6O2 |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-methyl-6-oxo-N-[4-(triazol-2-yl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccc(-n3nccn3)cc2)ccc1=O |
| InChI | InChI=1S/C14H12N6O2/c1-19-13(21)7-6-12(18-19)14(22)17-10-2-4-11(5-3-10)20-15-8-9-16-20/h2-9H,1H3,(H,17,22) |
| InChIKey | OBDYCLPARIXDLT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |