C24H22N4O — CID 60563144
1-phenyl-N-[4-(1-phenylethylamino)phenyl]pyrazole-3-carboxamide (PubChem CID 60563144) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-phenyl-N-[4-(1-phenylethylamino)phenyl]pyrazole-3-carboxamide.
| Compound Name | 1-phenyl-N-[4-(1-phenylethylamino)phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 60563144 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-phenyl-N-[4-(1-phenylethylamino)phenyl]pyrazole-3-carboxamide |
| SMILES | CC(Nc1ccc(NC(=O)c2ccn(-c3ccccc3)n2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H22N4O/c1-18(19-8-4-2-5-9-19)25-20-12-14-21(15-13-20)26-24(29)23-16-17-28(27-23)22-10-6-3-7-11-22/h2-18,25H,1H3,(H,26,29) |
| InChIKey | SCTXENAPHIFUDC-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |