C26H31N5O3S — CID 55547682
N-(1-phenylpyrazol-3-yl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55547682) has the molecular formula C26H31N5O3S and a molecular weight of 493.63 g/mol. Its IUPAC name is N-(1-phenylpyrazol-3-yl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(1-phenylpyrazol-3-yl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55547682 |
| Molecular Formula | C26H31N5O3S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | N-(1-phenylpyrazol-3-yl)-4-piperidin-1-yl-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(Nc1ccn(-c2ccccc2)n1)c1ccc(N2CCCCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C26H31N5O3S/c32-26(27-25-14-19-31(28-25)22-10-4-1-5-11-22)21-12-13-23(29-15-6-2-7-16-29)24(20-21)35(33,34)30-17-8-3-9-18-30/h1,4-5,10-14,19-20H,2-3,6-9,15-18H2,(H,27,28,32) |
| InChIKey | WWZKZAXDWYTKSS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |