C10H11ClN2O4S — CID 168640321
5-[(3-chloro-2-hydroxypropyl)amino]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 168640321) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is 5-[(3-chloro-2-hydroxypropyl)amino]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 5-[(3-chloro-2-hydroxypropyl)amino]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 168640321 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-[(3-chloro-2-hydroxypropyl)amino]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | O=C1NS(=O)(=O)c2ccc(NCC(O)CCl)cc21 |
| InChI | InChI=1S/C10H11ClN2O4S/c11-4-7(14)5-12-6-1-2-9-8(3-6)10(15)13-18(9,16)17/h1-3,7,12,14H,4-5H2,(H,13,15) |
| InChIKey | YMODDZGDIYFOPO-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|