C14H18ClF2NO2 — CID 168637854
1-chloro-3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propan-2-ol (PubChem CID 168637854) has the molecular formula C14H18ClF2NO2 and a molecular weight of 305.75 g/mol. Its IUPAC name is 1-chloro-3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propan-2-ol.
| Compound Name | 1-chloro-3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propan-2-ol |
|---|---|
| PubChem CID | 168637854 |
| Molecular Formula | C14H18ClF2NO2 |
| Molecular Weight | 305.75 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 1-chloro-3-[4-(cyclobutylmethoxy)-3,5-difluoroanilino]propan-2-ol |
| SMILES | OC(CCl)CNc1cc(F)c(OCC2CCC2)c(F)c1 |
| InChI | InChI=1S/C14H18ClF2NO2/c15-6-11(19)7-18-10-4-12(16)14(13(17)5-10)20-8-9-2-1-3-9/h4-5,9,11,18-19H,1-3,6-8H2 |
| InChIKey | VJWKGPCMVIQXAW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|