C9H8FN3OS — CID 169359243
(7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)thiourea (PubChem CID 169359243) has the molecular formula C9H8FN3OS and a molecular weight of 225.25 g/mol. Its IUPAC name is (7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)thiourea.
| Compound Name | (7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)thiourea |
|---|---|
| PubChem CID | 169359243 |
| Molecular Formula | C9H8FN3OS |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | (7-fluoro-3-oxo-1,2-dihydroisoindol-5-yl)thiourea |
| SMILES | NC(=S)Nc1cc(F)c2c(c1)C(=O)NC2 |
| InChI | InChI=1S/C9H8FN3OS/c10-7-2-4(13-9(11)15)1-5-6(7)3-12-8(5)14/h1-2H,3H2,(H,12,14)(H3,11,13,15) |
| InChIKey | OGEBMMTZTDGJGD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|