C8H5F5O — CID 130785750
1-(difluoromethyl)-2,3,5-trifluoro-4-methoxybenzene (PubChem CID 130785750) has the molecular formula C8H5F5O and a molecular weight of 212.12 g/mol. Its IUPAC name is 1-(difluoromethyl)-2,3,5-trifluoro-4-methoxybenzene.
| Compound Name | 1-(difluoromethyl)-2,3,5-trifluoro-4-methoxybenzene |
|---|---|
| PubChem CID | 130785750 |
| Molecular Formula | C8H5F5O |
| Molecular Weight | 212.12 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 1-(difluoromethyl)-2,3,5-trifluoro-4-methoxybenzene |
| SMILES | COc1c(F)cc(C(F)F)c(F)c1F |
| InChI | InChI=1S/C8H5F5O/c1-14-7-4(9)2-3(8(12)13)5(10)6(7)11/h2,8H,1H3 |
| InChIKey | ZWUCQFBLNCZGTO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.12 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|