C13H20F2O2 — CID 178095576
2-(3,5-difluoro-4-methoxy-2-methylphenyl)propan-2-ol;ethane (PubChem CID 178095576) has the molecular formula C13H20F2O2 and a molecular weight of 246.30 g/mol. Its IUPAC name is 2-(3,5-difluoro-4-methoxy-2-methylphenyl)propan-2-ol;ethane.
| Compound Name | 2-(3,5-difluoro-4-methoxy-2-methylphenyl)propan-2-ol;ethane |
|---|---|
| PubChem CID | 178095576 |
| Molecular Formula | C13H20F2O2 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-(3,5-difluoro-4-methoxy-2-methylphenyl)propan-2-ol;ethane |
| SMILES | CC.COc1c(F)cc(C(C)(C)O)c(C)c1F |
| InChI | InChI=1S/C11H14F2O2.C2H6/c1-6-7(11(2,3)14)5-8(12)10(15-4)9(6)13;1-2/h5,14H,1-4H3;1-2H3 |
| InChIKey | DONWEHLQRKSQKP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |