About 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide
2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide (PubChem CID 84711385) has the molecular formula C10H14BrFO2
and a molecular weight of 265.12 g/mol. Its IUPAC name is 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide.
Molecular Properties
| Compound Name | 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide |
| PubChem CID | 84711385 |
| Molecular Formula | C10H14BrFO2 |
| Molecular Weight | 265.12 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide |
| SMILES | Br.COc1c(F)cccc1C(C)(C)O |
| InChI | InChI=1S/C10H13FO2.BrH/c1-10(2,12)7-5-4-6-8(11)9(7)13-3;/h4-6,12H,1-3H3;1H |
| InChIKey | YFWQBHHFSATMBQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide?
The IUPAC name of 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide (CID 84711385) is 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide.
What is the SMILES notation for 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide?
The canonical SMILES for 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide is Br.COc1c(F)cccc1C(C)(C)O.
What is the InChIKey of 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide?
The InChIKey is YFWQBHHFSATMBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO2.BrH/c1-10(2,12)7-5-4-6-8(11)9(7)13-3;/h4-6,12H,1-3H3;1H.
What are the key properties of 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide?
2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide has a molecular weight of 265.12 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoro-2-methoxyphenyl)propan-2-ol;hydrobromide is sourced from PubChem (CID 84711385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).