C12H18O3S — CID 117358289
2-(2,3-dimethoxy-4-methylsulfanylphenyl)propan-2-ol (PubChem CID 117358289) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 2-(2,3-dimethoxy-4-methylsulfanylphenyl)propan-2-ol.
| Compound Name | 2-(2,3-dimethoxy-4-methylsulfanylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117358289 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-(2,3-dimethoxy-4-methylsulfanylphenyl)propan-2-ol |
| SMILES | COc1c(SC)ccc(C(C)(C)O)c1OC |
| InChI | InChI=1S/C12H18O3S/c1-12(2,13)8-6-7-9(16-5)11(15-4)10(8)14-3/h6-7,13H,1-5H3 |
| InChIKey | UWUOQKFDDMPTOF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |