C10H13BrClNO3 — CID 117495457
1-(4-bromo-6-chloro-2,3-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117495457) has the molecular formula C10H13BrClNO3 and a molecular weight of 310.58 g/mol. Its IUPAC name is 1-(4-bromo-6-chloro-2,3-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(4-bromo-6-chloro-2,3-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117495457 |
| Molecular Formula | C10H13BrClNO3 |
| Molecular Weight | 310.58 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 1-(4-bromo-6-chloro-2,3-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(Cl)cc(Br)c(OC)c1OC |
| InChI | InChI=1S/C10H13BrClNO3/c1-14-9-6(5-13-16-3)8(12)4-7(11)10(9)15-2/h4,13H,5H2,1-3H3 |
| InChIKey | MAMMEGOTCUCVKB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.58 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|