C10H11BrF2O3 — CID 164741411
3-(bromomethyl)-4-ethylperoxy-1,2-difluoro-5-methoxybenzene (PubChem CID 164741411) has the molecular formula C10H11BrF2O3 and a molecular weight of 297.10 g/mol. Its IUPAC name is 3-(bromomethyl)-4-ethylperoxy-1,2-difluoro-5-methoxybenzene.
| Compound Name | 3-(bromomethyl)-4-ethylperoxy-1,2-difluoro-5-methoxybenzene |
|---|---|
| PubChem CID | 164741411 |
| Molecular Formula | C10H11BrF2O3 |
| Molecular Weight | 297.10 g/mol |
| Exact Mass | 295.99 |
| IUPAC Name | 3-(bromomethyl)-4-ethylperoxy-1,2-difluoro-5-methoxybenzene |
| SMILES | CCOOc1c(OC)cc(F)c(F)c1CBr |
| InChI | InChI=1S/C10H11BrF2O3/c1-3-15-16-10-6(5-11)9(13)7(12)4-8(10)14-2/h4H,3,5H2,1-2H3 |
| InChIKey | NNHPVLFWVCFMNG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.10 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|