C16H26N2O4 — CID 119690656
2-amino-3-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]pentanamide (PubChem CID 119690656) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-amino-3-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]pentanamide.
| Compound Name | 2-amino-3-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 119690656 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-amino-3-methyl-N-[(2,4,5-trimethoxyphenyl)methyl]pentanamide |
| SMILES | CCC(C)C(N)C(=O)NCc1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C16H26N2O4/c1-6-10(2)15(17)16(19)18-9-11-7-13(21-4)14(22-5)8-12(11)20-3/h7-8,10,15H,6,9,17H2,1-5H3,(H,18,19) |
| InChIKey | ZAGUFHJJZUQASJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |