C14H22N2O3 — CID 115168734
1-[2-(2,5-dimethoxy-3,4-dimethylphenyl)ethyl]-1-methylurea (PubChem CID 115168734) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[2-(2,5-dimethoxy-3,4-dimethylphenyl)ethyl]-1-methylurea.
| Compound Name | 1-[2-(2,5-dimethoxy-3,4-dimethylphenyl)ethyl]-1-methylurea |
|---|---|
| PubChem CID | 115168734 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-[2-(2,5-dimethoxy-3,4-dimethylphenyl)ethyl]-1-methylurea |
| SMILES | COc1cc(CCN(C)C(N)=O)c(OC)c(C)c1C |
| InChI | InChI=1S/C14H22N2O3/c1-9-10(2)13(19-5)11(8-12(9)18-4)6-7-16(3)14(15)17/h8H,6-7H2,1-5H3,(H2,15,17) |
| InChIKey | DIFRNTYVFFWNOW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |