C14H21NO4 — CID 115232849
methyl 2-(2,5-dimethoxy-N,3,4-trimethylanilino)acetate (PubChem CID 115232849) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is methyl 2-(2,5-dimethoxy-N,3,4-trimethylanilino)acetate.
| Compound Name | methyl 2-(2,5-dimethoxy-N,3,4-trimethylanilino)acetate |
|---|---|
| PubChem CID | 115232849 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | methyl 2-(2,5-dimethoxy-N,3,4-trimethylanilino)acetate |
| SMILES | COC(=O)CN(C)c1cc(OC)c(C)c(C)c1OC |
| InChI | InChI=1S/C14H21NO4/c1-9-10(2)14(19-6)11(7-12(9)17-4)15(3)8-13(16)18-5/h7H,8H2,1-6H3 |
| InChIKey | HIUBCDHBFWZPKX-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |