C15H23NO3 — CID 115257305
ethyl 2-(4-methoxy-N,2,3,5-tetramethylanilino)acetate (PubChem CID 115257305) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is ethyl 2-(4-methoxy-N,2,3,5-tetramethylanilino)acetate.
| Compound Name | ethyl 2-(4-methoxy-N,2,3,5-tetramethylanilino)acetate |
|---|---|
| PubChem CID | 115257305 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | ethyl 2-(4-methoxy-N,2,3,5-tetramethylanilino)acetate |
| SMILES | CCOC(=O)CN(C)c1cc(C)c(OC)c(C)c1C |
| InChI | InChI=1S/C15H23NO3/c1-7-19-14(17)9-16(5)13-8-10(2)15(18-6)12(4)11(13)3/h8H,7,9H2,1-6H3 |
| InChIKey | OLCWYELBTHIFNM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|