methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate

C14H21NO3 — CID 115232845

IUPACmethyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate
SMILESCOC(=O)CN(C)c1c(C)cc(C)c(C)c1OC
InChIInChI=1S/C14H21NO3/c1-9-7-10(2)13(14(18-6)11(9)3)15(4)8-12(16)17-5/h7H,8H2,1-6H3
InChIKeyYWGWHDOIJBQGLU-UHFFFAOYSA-N
MW251.33 g/mol
LogP2.23
Rot. Bonds4

About methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate

methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate (PubChem CID 115232845) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate
PubChem CID115232845
Molecular FormulaC14H21NO3
Molecular Weight251.33 g/mol
Exact Mass251.15
IUPAC Namemethyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate
SMILESCOC(=O)CN(C)c1c(C)cc(C)c(C)c1OC
InChIInChI=1S/C14H21NO3/c1-9-7-10(2)13(14(18-6)11(9)3)15(4)8-12(16)17-5/h7H,8H2,1-6H3
InChIKeyYWGWHDOIJBQGLU-UHFFFAOYSA-N
XLogP2.23
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.33
LogP ≤ 52.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate?
The IUPAC name of methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate (CID 115232845) is methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate.
What is the SMILES notation for methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate?
The canonical SMILES for methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate is COC(=O)CN(C)c1c(C)cc(C)c(C)c1OC.
What is the InChIKey of methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate?
The InChIKey is YWGWHDOIJBQGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO3/c1-9-7-10(2)13(14(18-6)11(9)3)15(4)8-12(16)17-5/h7H,8H2,1-6H3.
What are the key properties of methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate?
methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate has a molecular weight of 251.33 g/mol, XLogP of 2.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methoxy-N,3,4,6-tetramethylanilino)acetate is sourced from PubChem (CID 115232845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).