C14H21NO2 — CID 115235463
4-(2-methoxy-3,4,6-trimethylanilino)butan-2-one (PubChem CID 115235463) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-(2-methoxy-3,4,6-trimethylanilino)butan-2-one.
| Compound Name | 4-(2-methoxy-3,4,6-trimethylanilino)butan-2-one |
|---|---|
| PubChem CID | 115235463 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-(2-methoxy-3,4,6-trimethylanilino)butan-2-one |
| SMILES | COc1c(C)c(C)cc(C)c1NCCC(C)=O |
| InChI | InChI=1S/C14H21NO2/c1-9-8-10(2)13(14(17-5)12(9)4)15-7-6-11(3)16/h8,15H,6-7H2,1-5H3 |
| InChIKey | SNWKTRXWERPADQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |