C12H17NO3 — CID 115190424
methyl N-(2-methoxy-3,4,6-trimethylphenyl)carbamate (PubChem CID 115190424) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl N-(2-methoxy-3,4,6-trimethylphenyl)carbamate.
| Compound Name | methyl N-(2-methoxy-3,4,6-trimethylphenyl)carbamate |
|---|---|
| PubChem CID | 115190424 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl N-(2-methoxy-3,4,6-trimethylphenyl)carbamate |
| SMILES | COC(=O)Nc1c(C)cc(C)c(C)c1OC |
| InChI | InChI=1S/C12H17NO3/c1-7-6-8(2)10(13-12(14)16-5)11(15-4)9(7)3/h6H,1-5H3,(H,13,14) |
| InChIKey | GZKLDOHWKPVWCK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |