C10H13NO3 — CID 46786378
methyl N-(4-hydroxy-2,6-dimethylphenyl)carbamate (PubChem CID 46786378) has the molecular formula C10H13NO3 and a molecular weight of 195.22 g/mol. Its IUPAC name is methyl N-(4-hydroxy-2,6-dimethylphenyl)carbamate.
| Compound Name | methyl N-(4-hydroxy-2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 46786378 |
| Molecular Formula | C10H13NO3 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | methyl N-(4-hydroxy-2,6-dimethylphenyl)carbamate |
| SMILES | COC(=O)Nc1c(C)cc(O)cc1C |
| InChI | InChI=1S/C10H13NO3/c1-6-4-8(12)5-7(2)9(6)11-10(13)14-3/h4-5,12H,1-3H3,(H,11,13) |
| InChIKey | VWOCEHUCNAQMEW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|