C14H22N2O2 — CID 115155164
4-amino-N-(2-methoxy-3,4,6-trimethylphenyl)butanamide (PubChem CID 115155164) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 4-amino-N-(2-methoxy-3,4,6-trimethylphenyl)butanamide.
| Compound Name | 4-amino-N-(2-methoxy-3,4,6-trimethylphenyl)butanamide |
|---|---|
| PubChem CID | 115155164 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 4-amino-N-(2-methoxy-3,4,6-trimethylphenyl)butanamide |
| SMILES | COc1c(C)c(C)cc(C)c1NC(=O)CCCN |
| InChI | InChI=1S/C14H22N2O2/c1-9-8-10(2)13(14(18-4)11(9)3)16-12(17)6-5-7-15/h8H,5-7,15H2,1-4H3,(H,16,17) |
| InChIKey | VBQDWQGBWDALBE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |