C11H14F2N2O2 — CID 119290632
4-amino-N-(3,5-difluoro-4-methoxyphenyl)butanamide (PubChem CID 119290632) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 4-amino-N-(3,5-difluoro-4-methoxyphenyl)butanamide.
| Compound Name | 4-amino-N-(3,5-difluoro-4-methoxyphenyl)butanamide |
|---|---|
| PubChem CID | 119290632 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-amino-N-(3,5-difluoro-4-methoxyphenyl)butanamide |
| SMILES | COc1c(F)cc(NC(=O)CCCN)cc1F |
| InChI | InChI=1S/C11H14F2N2O2/c1-17-11-8(12)5-7(6-9(11)13)15-10(16)3-2-4-14/h5-6H,2-4,14H2,1H3,(H,15,16) |
| InChIKey | YHZXCBXLQAGWSB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |