C15H23NO2 — CID 115235985
4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-2-one (PubChem CID 115235985) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-2-one.
| Compound Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-2-one |
|---|---|
| PubChem CID | 115235985 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-[2-(4-methoxy-3,5-dimethylphenyl)ethylamino]butan-2-one |
| SMILES | COc1c(C)cc(CCNCCC(C)=O)cc1C |
| InChI | InChI=1S/C15H23NO2/c1-11-9-14(10-12(2)15(11)18-4)6-8-16-7-5-13(3)17/h9-10,16H,5-8H2,1-4H3 |
| InChIKey | BDFLCJFWLQYOSL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|