C15H24N2O2 — CID 116847658
3-(2-methoxy-3,4,6-trimethylphenyl)-N',N'-dimethylpropanehydrazide (PubChem CID 116847658) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-(2-methoxy-3,4,6-trimethylphenyl)-N',N'-dimethylpropanehydrazide.
| Compound Name | 3-(2-methoxy-3,4,6-trimethylphenyl)-N',N'-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 116847658 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 3-(2-methoxy-3,4,6-trimethylphenyl)-N',N'-dimethylpropanehydrazide |
| SMILES | COc1c(C)c(C)cc(C)c1CCC(=O)NN(C)C |
| InChI | InChI=1S/C15H24N2O2/c1-10-9-11(2)13(15(19-6)12(10)3)7-8-14(18)16-17(4)5/h9H,7-8H2,1-6H3,(H,16,18) |
| InChIKey | GXPYDJSXYDBCJO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|