C15H24N2O — CID 116847580
N',N'-dimethyl-3-(2,3,5,6-tetramethylphenyl)propanehydrazide (PubChem CID 116847580) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N',N'-dimethyl-3-(2,3,5,6-tetramethylphenyl)propanehydrazide.
| Compound Name | N',N'-dimethyl-3-(2,3,5,6-tetramethylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116847580 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N',N'-dimethyl-3-(2,3,5,6-tetramethylphenyl)propanehydrazide |
| SMILES | Cc1cc(C)c(C)c(CCC(=O)NN(C)C)c1C |
| InChI | InChI=1S/C15H24N2O/c1-10-9-11(2)13(4)14(12(10)3)7-8-15(18)16-17(5)6/h9H,7-8H2,1-6H3,(H,16,18) |
| InChIKey | UYDZRTYZIKFOOW-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|