C13H19FN2O — CID 116847682
4-(4-fluoro-3-methylphenyl)-N',N'-dimethylbutanehydrazide (PubChem CID 116847682) has the molecular formula C13H19FN2O and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-(4-fluoro-3-methylphenyl)-N',N'-dimethylbutanehydrazide.
| Compound Name | 4-(4-fluoro-3-methylphenyl)-N',N'-dimethylbutanehydrazide |
|---|---|
| PubChem CID | 116847682 |
| Molecular Formula | C13H19FN2O |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | 4-(4-fluoro-3-methylphenyl)-N',N'-dimethylbutanehydrazide |
| SMILES | Cc1cc(CCCC(=O)NN(C)C)ccc1F |
| InChI | InChI=1S/C13H19FN2O/c1-10-9-11(7-8-12(10)14)5-4-6-13(17)15-16(2)3/h7-9H,4-6H2,1-3H3,(H,15,17) |
| InChIKey | RRTOTIGIUGKBAR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|