C14H22N2OS — CID 116847805
N',N'-dimethyl-5-(4-methylsulfanylphenyl)pentanehydrazide (PubChem CID 116847805) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N',N'-dimethyl-5-(4-methylsulfanylphenyl)pentanehydrazide.
| Compound Name | N',N'-dimethyl-5-(4-methylsulfanylphenyl)pentanehydrazide |
|---|---|
| PubChem CID | 116847805 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N',N'-dimethyl-5-(4-methylsulfanylphenyl)pentanehydrazide |
| SMILES | CSc1ccc(CCCCC(=O)NN(C)C)cc1 |
| InChI | InChI=1S/C14H22N2OS/c1-16(2)15-14(17)7-5-4-6-12-8-10-13(18-3)11-9-12/h8-11H,4-7H2,1-3H3,(H,15,17) |
| InChIKey | QSZBHUHDBHXANF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|