C13H19BrN2O — CID 116847827
5-(2-bromophenyl)-N',N'-dimethylpentanehydrazide (PubChem CID 116847827) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 5-(2-bromophenyl)-N',N'-dimethylpentanehydrazide.
| Compound Name | 5-(2-bromophenyl)-N',N'-dimethylpentanehydrazide |
|---|---|
| PubChem CID | 116847827 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-(2-bromophenyl)-N',N'-dimethylpentanehydrazide |
| SMILES | CN(C)NC(=O)CCCCc1ccccc1Br |
| InChI | InChI=1S/C13H19BrN2O/c1-16(2)15-13(17)10-6-4-8-11-7-3-5-9-12(11)14/h3,5,7,9H,4,6,8,10H2,1-2H3,(H,15,17) |
| InChIKey | QPEWUBURJJDAJJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|