C11H15BrN2O — CID 116843802
5-(2-bromophenyl)pentanehydrazide (PubChem CID 116843802) has the molecular formula C11H15BrN2O and a molecular weight of 271.16 g/mol. Its IUPAC name is 5-(2-bromophenyl)pentanehydrazide.
| Compound Name | 5-(2-bromophenyl)pentanehydrazide |
|---|---|
| PubChem CID | 116843802 |
| Molecular Formula | C11H15BrN2O |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-(2-bromophenyl)pentanehydrazide |
| SMILES | NNC(=O)CCCCc1ccccc1Br |
| InChI | InChI=1S/C11H15BrN2O/c12-10-7-3-1-5-9(10)6-2-4-8-11(15)14-13/h1,3,5,7H,2,4,6,8,13H2,(H,14,15) |
| InChIKey | SIXPDNKEWMVMMW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|