C12H18OS — CID 116927327
2-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol (PubChem CID 116927327) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 2-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol.
| Compound Name | 2-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol |
|---|---|
| PubChem CID | 116927327 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 2-(2-methoxy-3,4,6-trimethylphenyl)ethanethiol |
| SMILES | COc1c(C)c(C)cc(C)c1CCS |
| InChI | InChI=1S/C12H18OS/c1-8-7-9(2)11(5-6-14)12(13-4)10(8)3/h7,14H,5-6H2,1-4H3 |
| InChIKey | JGRSYTVZJROZMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|