C12H17ClOS — CID 83940433
3-(5-chloro-2-methoxy-3,6-dimethylphenyl)propane-1-thiol (PubChem CID 83940433) has the molecular formula C12H17ClOS and a molecular weight of 244.79 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxy-3,6-dimethylphenyl)propane-1-thiol.
| Compound Name | 3-(5-chloro-2-methoxy-3,6-dimethylphenyl)propane-1-thiol |
|---|---|
| PubChem CID | 83940433 |
| Molecular Formula | C12H17ClOS |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(5-chloro-2-methoxy-3,6-dimethylphenyl)propane-1-thiol |
| SMILES | COc1c(C)cc(Cl)c(C)c1CCCS |
| InChI | InChI=1S/C12H17ClOS/c1-8-7-11(13)9(2)10(5-4-6-15)12(8)14-3/h7,15H,4-6H2,1-3H3 |
| InChIKey | JQZXXMRZKTWJEY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|