C12H15ClO3 — CID 82552401
methyl 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetate (PubChem CID 82552401) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is methyl 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetate.
| Compound Name | methyl 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 82552401 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | methyl 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetate |
| SMILES | COC(=O)Cc1c(C)c(Cl)cc(C)c1OC |
| InChI | InChI=1S/C12H15ClO3/c1-7-5-10(13)8(2)9(12(7)16-4)6-11(14)15-3/h5H,6H2,1-4H3 |
| InChIKey | VUWDQKMJWIBFIE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |