C11H12ClNO — CID 84781042
2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetonitrile (PubChem CID 84781042) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetonitrile.
| Compound Name | 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 84781042 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(5-chloro-2-methoxy-3,6-dimethylphenyl)acetonitrile |
| SMILES | COc1c(C)cc(Cl)c(C)c1CC#N |
| InChI | InChI=1S/C11H12ClNO/c1-7-6-10(12)8(2)9(4-5-13)11(7)14-3/h6H,4H2,1-3H3 |
| InChIKey | CZFUEIBVOKETER-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |