C14H18ClNO — CID 83940496
4-(5-chloro-2-methoxy-3,6-dimethylphenyl)pentanenitrile (PubChem CID 83940496) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 4-(5-chloro-2-methoxy-3,6-dimethylphenyl)pentanenitrile.
| Compound Name | 4-(5-chloro-2-methoxy-3,6-dimethylphenyl)pentanenitrile |
|---|---|
| PubChem CID | 83940496 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 4-(5-chloro-2-methoxy-3,6-dimethylphenyl)pentanenitrile |
| SMILES | COc1c(C)cc(Cl)c(C)c1C(C)CCC#N |
| InChI | InChI=1S/C14H18ClNO/c1-9(6-5-7-16)13-11(3)12(15)8-10(2)14(13)17-4/h8-9H,5-6H2,1-4H3 |
| InChIKey | ARUIWUZYXDKYRD-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |