C11H16ClNO2 — CID 84693141
2-(5-chloro-2,3-dimethoxy-6-methylphenyl)ethanamine (PubChem CID 84693141) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is 2-(5-chloro-2,3-dimethoxy-6-methylphenyl)ethanamine.
| Compound Name | 2-(5-chloro-2,3-dimethoxy-6-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 84693141 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(5-chloro-2,3-dimethoxy-6-methylphenyl)ethanamine |
| SMILES | COc1cc(Cl)c(C)c(CCN)c1OC |
| InChI | InChI=1S/C11H16ClNO2/c1-7-8(4-5-13)11(15-3)10(14-2)6-9(7)12/h6H,4-5,13H2,1-3H3 |
| InChIKey | RMZSIKAXDZYSHW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |