C10H14ClNO4 — CID 117372417
O-[(3-chloro-2,5,6-trimethoxyphenyl)methyl]hydroxylamine (PubChem CID 117372417) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is O-[(3-chloro-2,5,6-trimethoxyphenyl)methyl]hydroxylamine.
| Compound Name | O-[(3-chloro-2,5,6-trimethoxyphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117372417 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | O-[(3-chloro-2,5,6-trimethoxyphenyl)methyl]hydroxylamine |
| SMILES | COc1cc(Cl)c(OC)c(CON)c1OC |
| InChI | InChI=1S/C10H14ClNO4/c1-13-8-4-7(11)9(14-2)6(5-16-12)10(8)15-3/h4H,5,12H2,1-3H3 |
| InChIKey | IDMIUJDSHMHKAF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|