methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate

C13H19NO3 — CID 115232790

IUPACmethyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate
SMILESCOC(=O)CN(C)c1ccc(OC)c(C)c1C
InChIInChI=1S/C13H19NO3/c1-9-10(2)12(16-4)7-6-11(9)14(3)8-13(15)17-5/h6-7H,8H2,1-5H3
InChIKeyVAXOHBWUJMTUQQ-UHFFFAOYSA-N
MW237.30 g/mol
LogP1.92
Rot. Bonds4

About methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate

methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate (PubChem CID 115232790) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate.

Molecular Properties

Compound Namemethyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate
PubChem CID115232790
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Namemethyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate
SMILESCOC(=O)CN(C)c1ccc(OC)c(C)c1C
InChIInChI=1S/C13H19NO3/c1-9-10(2)12(16-4)7-6-11(9)14(3)8-13(15)17-5/h6-7H,8H2,1-5H3
InChIKeyVAXOHBWUJMTUQQ-UHFFFAOYSA-N
XLogP1.92
TPSA38.77 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 51.92
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}

Analyze methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate?
The IUPAC name of methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate (CID 115232790) is methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate.
What is the SMILES notation for methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate?
The canonical SMILES for methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate is COC(=O)CN(C)c1ccc(OC)c(C)c1C.
What is the InChIKey of methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate?
The InChIKey is VAXOHBWUJMTUQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-9-10(2)12(16-4)7-6-11(9)14(3)8-13(15)17-5/h6-7H,8H2,1-5H3.
What are the key properties of methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate?
methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate has a molecular weight of 237.30 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate is sourced from PubChem (CID 115232790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).