C13H19NO3 — CID 115232790
methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate (PubChem CID 115232790) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate.
| Compound Name | methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate |
|---|---|
| PubChem CID | 115232790 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | methyl 2-(4-methoxy-N,2,3-trimethylanilino)acetate |
| SMILES | COC(=O)CN(C)c1ccc(OC)c(C)c1C |
| InChI | InChI=1S/C13H19NO3/c1-9-10(2)12(16-4)7-6-11(9)14(3)8-13(15)17-5/h6-7H,8H2,1-5H3 |
| InChIKey | VAXOHBWUJMTUQQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|