C12H16F3NO2 — CID 115257712
2,5-dimethoxy-3,4-dimethyl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 115257712) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is 2,5-dimethoxy-3,4-dimethyl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2,5-dimethoxy-3,4-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 115257712 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | 2,5-dimethoxy-3,4-dimethyl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COc1cc(NCC(F)(F)F)c(OC)c(C)c1C |
| InChI | InChI=1S/C12H16F3NO2/c1-7-8(2)11(18-4)9(5-10(7)17-3)16-6-12(13,14)15/h5,16H,6H2,1-4H3 |
| InChIKey | IIZDIOYJSGXDLF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |