C9H8F5NO — CID 115257699
2,5-difluoro-4-methoxy-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 115257699) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is 2,5-difluoro-4-methoxy-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2,5-difluoro-4-methoxy-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 115257699 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2,5-difluoro-4-methoxy-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | COc1cc(F)c(NCC(F)(F)F)cc1F |
| InChI | InChI=1S/C9H8F5NO/c1-16-8-3-5(10)7(2-6(8)11)15-4-9(12,13)14/h2-3,15H,4H2,1H3 |
| InChIKey | HJNNRQMURKACMS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|