C9H11F2NO2 — CID 82648067
2-(2,5-difluoro-4-methoxyanilino)ethanol (PubChem CID 82648067) has the molecular formula C9H11F2NO2 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-methoxyanilino)ethanol.
| Compound Name | 2-(2,5-difluoro-4-methoxyanilino)ethanol |
|---|---|
| PubChem CID | 82648067 |
| Molecular Formula | C9H11F2NO2 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(2,5-difluoro-4-methoxyanilino)ethanol |
| SMILES | COc1cc(F)c(NCCO)cc1F |
| InChI | InChI=1S/C9H11F2NO2/c1-14-9-5-6(10)8(4-7(9)11)12-2-3-13/h4-5,12-13H,2-3H2,1H3 |
| InChIKey | WPVTZUFTDCKGJH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|