C12H15F2NO3 — CID 115136445
3-(2,5-difluoro-4-methoxyanilino)-2,2-dimethylpropanoic acid (PubChem CID 115136445) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 3-(2,5-difluoro-4-methoxyanilino)-2,2-dimethylpropanoic acid.
| Compound Name | 3-(2,5-difluoro-4-methoxyanilino)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 115136445 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-(2,5-difluoro-4-methoxyanilino)-2,2-dimethylpropanoic acid |
| SMILES | COc1cc(F)c(NCC(C)(C)C(=O)O)cc1F |
| InChI | InChI=1S/C12H15F2NO3/c1-12(2,11(16)17)6-15-9-4-8(14)10(18-3)5-7(9)13/h4-5,15H,6H2,1-3H3,(H,16,17) |
| InChIKey | XMARSCAADFHYDQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|