C8H8ClF2NO — CID 115262759
N-(chloromethyl)-2,5-difluoro-4-methoxyaniline (PubChem CID 115262759) has the molecular formula C8H8ClF2NO and a molecular weight of 207.61 g/mol. Its IUPAC name is N-(chloromethyl)-2,5-difluoro-4-methoxyaniline.
| Compound Name | N-(chloromethyl)-2,5-difluoro-4-methoxyaniline |
|---|---|
| PubChem CID | 115262759 |
| Molecular Formula | C8H8ClF2NO |
| Molecular Weight | 207.61 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | N-(chloromethyl)-2,5-difluoro-4-methoxyaniline |
| SMILES | COc1cc(F)c(NCCl)cc1F |
| InChI | InChI=1S/C8H8ClF2NO/c1-13-8-3-5(10)7(12-4-9)2-6(8)11/h2-3,12H,4H2,1H3 |
| InChIKey | NJULVIAQJUSAOI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.61 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|