C12H16F2N2O2 — CID 115237891
2,5-difluoro-4-methoxy-N-(morpholin-3-ylmethyl)aniline (PubChem CID 115237891) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 2,5-difluoro-4-methoxy-N-(morpholin-3-ylmethyl)aniline.
| Compound Name | 2,5-difluoro-4-methoxy-N-(morpholin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 115237891 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,5-difluoro-4-methoxy-N-(morpholin-3-ylmethyl)aniline |
| SMILES | COc1cc(F)c(NCC2COCCN2)cc1F |
| InChI | InChI=1S/C12H16F2N2O2/c1-17-12-5-9(13)11(4-10(12)14)16-6-8-7-18-3-2-15-8/h4-5,8,15-16H,2-3,6-7H2,1H3 |
| InChIKey | CRIAPQDKZGOECZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|