C12H16FNO2 — CID 82287541
3-[(5-fluoro-2-methoxyphenyl)methyl]morpholine (PubChem CID 82287541) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is 3-[(5-fluoro-2-methoxyphenyl)methyl]morpholine.
| Compound Name | 3-[(5-fluoro-2-methoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 82287541 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3-[(5-fluoro-2-methoxyphenyl)methyl]morpholine |
| SMILES | COc1ccc(F)cc1CC1COCCN1 |
| InChI | InChI=1S/C12H16FNO2/c1-15-12-3-2-10(13)6-9(12)7-11-8-16-5-4-14-11/h2-3,6,11,14H,4-5,7-8H2,1H3 |
| InChIKey | PUEDZHOIEULCGF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |