C14H21NO2 — CID 116928186
3-[2-(4-methoxy-3-methylphenyl)ethyl]morpholine (PubChem CID 116928186) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-[2-(4-methoxy-3-methylphenyl)ethyl]morpholine.
| Compound Name | 3-[2-(4-methoxy-3-methylphenyl)ethyl]morpholine |
|---|---|
| PubChem CID | 116928186 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-[2-(4-methoxy-3-methylphenyl)ethyl]morpholine |
| SMILES | COc1ccc(CCC2COCCN2)cc1C |
| InChI | InChI=1S/C14H21NO2/c1-11-9-12(4-6-14(11)16-2)3-5-13-10-17-8-7-15-13/h4,6,9,13,15H,3,5,7-8,10H2,1-2H3 |
| InChIKey | ZDFURWAYBVCQHT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |