C14H22N2O2 — CID 115237844
3-ethyl-4-methoxy-N-(morpholin-3-ylmethyl)aniline (PubChem CID 115237844) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-ethyl-4-methoxy-N-(morpholin-3-ylmethyl)aniline.
| Compound Name | 3-ethyl-4-methoxy-N-(morpholin-3-ylmethyl)aniline |
|---|---|
| PubChem CID | 115237844 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 3-ethyl-4-methoxy-N-(morpholin-3-ylmethyl)aniline |
| SMILES | CCc1cc(NCC2COCCN2)ccc1OC |
| InChI | InChI=1S/C14H22N2O2/c1-3-11-8-12(4-5-14(11)17-2)16-9-13-10-18-7-6-15-13/h4-5,8,13,15-16H,3,6-7,9-10H2,1-2H3 |
| InChIKey | NYFKWVJDOUXZQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|