C13H19BrN2O2 — CID 115238841
3-bromo-4-methoxy-N-(2-morpholin-3-ylethyl)aniline (PubChem CID 115238841) has the molecular formula C13H19BrN2O2 and a molecular weight of 315.21 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-(2-morpholin-3-ylethyl)aniline.
| Compound Name | 3-bromo-4-methoxy-N-(2-morpholin-3-ylethyl)aniline |
|---|---|
| PubChem CID | 115238841 |
| Molecular Formula | C13H19BrN2O2 |
| Molecular Weight | 315.21 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 3-bromo-4-methoxy-N-(2-morpholin-3-ylethyl)aniline |
| SMILES | COc1ccc(NCCC2COCCN2)cc1Br |
| InChI | InChI=1S/C13H19BrN2O2/c1-17-13-3-2-10(8-12(13)14)15-5-4-11-9-18-7-6-16-11/h2-3,8,11,15-16H,4-7,9H2,1H3 |
| InChIKey | SYJDAWJBNKIGRJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|