C12H18F2N2O — CID 115200419
1-N-(2,5-difluoro-4-methoxyphenyl)-3-methylbutane-1,3-diamine (PubChem CID 115200419) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is 1-N-(2,5-difluoro-4-methoxyphenyl)-3-methylbutane-1,3-diamine.
| Compound Name | 1-N-(2,5-difluoro-4-methoxyphenyl)-3-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 115200419 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | 1-N-(2,5-difluoro-4-methoxyphenyl)-3-methylbutane-1,3-diamine |
| SMILES | COc1cc(F)c(NCCC(C)(C)N)cc1F |
| InChI | InChI=1S/C12H18F2N2O/c1-12(2,15)4-5-16-10-6-9(14)11(17-3)7-8(10)13/h6-7,16H,4-5,15H2,1-3H3 |
| InChIKey | NBSWYZCUNVWIPR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|