C11H12F3NO2 — CID 79624686
2,2-dimethyl-3-(2,4,5-trifluoroanilino)propanoic acid (PubChem CID 79624686) has the molecular formula C11H12F3NO2 and a molecular weight of 247.22 g/mol. Its IUPAC name is 2,2-dimethyl-3-(2,4,5-trifluoroanilino)propanoic acid.
| Compound Name | 2,2-dimethyl-3-(2,4,5-trifluoroanilino)propanoic acid |
|---|---|
| PubChem CID | 79624686 |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 2,2-dimethyl-3-(2,4,5-trifluoroanilino)propanoic acid |
| SMILES | CC(C)(CNc1cc(F)c(F)cc1F)C(=O)O |
| InChI | InChI=1S/C11H12F3NO2/c1-11(2,10(16)17)5-15-9-4-7(13)6(12)3-8(9)14/h3-4,15H,5H2,1-2H3,(H,16,17) |
| InChIKey | MJRHBKOZFLEWDU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|